C14H9N3O3S — CID 584602
2-(1,3-benzothiazol-2-yliminomethyl)-4-nitrophenol (PubChem CID 584602) has the molecular formula C14H9N3O3S and a molecular weight of 299.31 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yliminomethyl)-4-nitrophenol.
| Compound Name | 2-(1,3-benzothiazol-2-yliminomethyl)-4-nitrophenol |
|---|---|
| PubChem CID | 584602 |
| Molecular Formula | C14H9N3O3S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yliminomethyl)-4-nitrophenol |
| SMILES | O=[N+]([O-])c1ccc(O)c(C=Nc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C14H9N3O3S/c18-12-6-5-10(17(19)20)7-9(12)8-15-14-16-11-3-1-2-4-13(11)21-14/h1-8,18H |
| InChIKey | WSKUZAQVRSHTBT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|