C25H16FN3O3S2 — CID 135594314
2-[[2-[(4-fluoronaphthalen-1-yl)methylsulfanyl]-1,3-benzothiazol-6-yl]iminomethyl]-4-nitrophenol (PubChem CID 135594314) has the molecular formula C25H16FN3O3S2 and a molecular weight of 489.55 g/mol. Its IUPAC name is 2-[[2-[(4-fluoronaphthalen-1-yl)methylsulfanyl]-1,3-benzothiazol-6-yl]iminomethyl]-4-nitrophenol.
| Compound Name | 2-[[2-[(4-fluoronaphthalen-1-yl)methylsulfanyl]-1,3-benzothiazol-6-yl]iminomethyl]-4-nitrophenol |
|---|---|
| PubChem CID | 135594314 |
| Molecular Formula | C25H16FN3O3S2 |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.06 |
| IUPAC Name | 2-[[2-[(4-fluoronaphthalen-1-yl)methylsulfanyl]-1,3-benzothiazol-6-yl]iminomethyl]-4-nitrophenol |
| SMILES | O=[N+]([O-])c1ccc(O)c(/C=N/c2ccc3nc(SCc4ccc(F)c5ccccc45)sc3c2)c1 |
| InChI | InChI=1S/C25H16FN3O3S2/c26-21-8-5-15(19-3-1-2-4-20(19)21)14-33-25-28-22-9-6-17(12-24(22)34-25)27-13-16-11-18(29(31)32)7-10-23(16)30/h1-13,30H,14H2/b27-13+ |
| InChIKey | HNPJMVPILJUVQU-UVHMKAGCSA-N |
| XLogP | 7.25 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|