C23H19N3O5S2 — CID 135815488
2-methoxy-6-[[2-[(2-methoxy-5-nitrophenyl)methylsulfanyl]-1,3-benzothiazol-6-yl]iminomethyl]phenol (PubChem CID 135815488) has the molecular formula C23H19N3O5S2 and a molecular weight of 481.56 g/mol. Its IUPAC name is 2-methoxy-6-[[2-[(2-methoxy-5-nitrophenyl)methylsulfanyl]-1,3-benzothiazol-6-yl]iminomethyl]phenol.
| Compound Name | 2-methoxy-6-[[2-[(2-methoxy-5-nitrophenyl)methylsulfanyl]-1,3-benzothiazol-6-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135815488 |
| Molecular Formula | C23H19N3O5S2 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | 2-methoxy-6-[[2-[(2-methoxy-5-nitrophenyl)methylsulfanyl]-1,3-benzothiazol-6-yl]iminomethyl]phenol |
| SMILES | COc1ccc([N+](=O)[O-])cc1CSc1nc2ccc(/N=C/c3cccc(OC)c3O)cc2s1 |
| InChI | InChI=1S/C23H19N3O5S2/c1-30-19-9-7-17(26(28)29)10-15(19)13-32-23-25-18-8-6-16(11-21(18)33-23)24-12-14-4-3-5-20(31-2)22(14)27/h3-12,27H,13H2,1-2H3/b24-12+ |
| InChIKey | VGBDPWCZAMUBMN-WYMPLXKRSA-N |
| XLogP | 5.97 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|