C22H14FN3O4S2 — CID 135709505
1-(4-fluorophenyl)-2-[[6-[(2-hydroxy-5-nitrophenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]ethanone (PubChem CID 135709505) has the molecular formula C22H14FN3O4S2 and a molecular weight of 467.50 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-[[6-[(2-hydroxy-5-nitrophenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]ethanone.
| Compound Name | 1-(4-fluorophenyl)-2-[[6-[(2-hydroxy-5-nitrophenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 135709505 |
| Molecular Formula | C22H14FN3O4S2 |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.04 |
| IUPAC Name | 1-(4-fluorophenyl)-2-[[6-[(2-hydroxy-5-nitrophenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]ethanone |
| SMILES | O=C(CSc1nc2ccc(/N=C/c3cc([N+](=O)[O-])ccc3O)cc2s1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H14FN3O4S2/c23-15-3-1-13(2-4-15)20(28)12-31-22-25-18-7-5-16(10-21(18)32-22)24-11-14-9-17(26(29)30)6-8-19(14)27/h1-11,27H,12H2/b24-11+ |
| InChIKey | SQAGMAQGOYNKSK-BHGWPJFGSA-N |
| XLogP | 5.77 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|