C28H18Cl2N2OS2 — CID 98105645
2-[[6-[(2,4-dichlorophenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-1-(4-phenylphenyl)ethanone (PubChem CID 98105645) has the molecular formula C28H18Cl2N2OS2 and a molecular weight of 533.51 g/mol. Its IUPAC name is 2-[[6-[(2,4-dichlorophenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-1-(4-phenylphenyl)ethanone.
| Compound Name | 2-[[6-[(2,4-dichlorophenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-1-(4-phenylphenyl)ethanone |
|---|---|
| PubChem CID | 98105645 |
| Molecular Formula | C28H18Cl2N2OS2 |
| Molecular Weight | 533.51 g/mol |
| Exact Mass | 532.02 |
| IUPAC Name | 2-[[6-[(2,4-dichlorophenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-1-(4-phenylphenyl)ethanone |
| SMILES | O=C(CSc1nc2ccc(/N=C/c3ccc(Cl)cc3Cl)cc2s1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H18Cl2N2OS2/c29-22-11-10-21(24(30)14-22)16-31-23-12-13-25-27(15-23)35-28(32-25)34-17-26(33)20-8-6-19(7-9-20)18-4-2-1-3-5-18/h1-16H,17H2/b31-16+ |
| InChIKey | OPDGXGGISCRFCC-WCMJOSRZSA-N |
| XLogP | 9.00 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.51 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|