C22H14Cl2N4O3S2 — CID 124529606
2-[[6-[(2,4-dichlorophenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(4-nitrophenyl)acetamide (PubChem CID 124529606) has the molecular formula C22H14Cl2N4O3S2 and a molecular weight of 517.42 g/mol. Its IUPAC name is 2-[[6-[(2,4-dichlorophenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[[6-[(2,4-dichlorophenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 124529606 |
| Molecular Formula | C22H14Cl2N4O3S2 |
| Molecular Weight | 517.42 g/mol |
| Exact Mass | 515.99 |
| IUPAC Name | 2-[[6-[(2,4-dichlorophenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
| SMILES | O=C(CSc1nc2ccc(/N=C/c3ccc(Cl)cc3Cl)cc2s1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H14Cl2N4O3S2/c23-14-2-1-13(18(24)9-14)11-25-16-5-8-19-20(10-16)33-22(27-19)32-12-21(29)26-15-3-6-17(7-4-15)28(30)31/h1-11H,12H2,(H,26,29)/b25-11+ |
| InChIKey | VCMGNMXFXBJQJB-OPEKNORGSA-N |
| XLogP | 6.99 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.42 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|