C29H18N6O5S4 — CID 99654998
2-[[6-[[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(4-nitrophenyl)acetamide (PubChem CID 99654998) has the molecular formula C29H18N6O5S4 and a molecular weight of 658.77 g/mol. Its IUPAC name is 2-[[6-[[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[[6-[[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 99654998 |
| Molecular Formula | C29H18N6O5S4 |
| Molecular Weight | 658.77 g/mol |
| Exact Mass | 658.02 |
| IUPAC Name | 2-[[6-[[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
| SMILES | O=C(CSc1nc2ccc(/N=C/c3ccc(Sc4nc5ccccc5s4)c([N+](=O)[O-])c3)cc2s1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H18N6O5S4/c36-27(31-18-6-9-20(10-7-18)34(37)38)16-41-28-32-22-11-8-19(14-26(22)44-28)30-15-17-5-12-25(23(13-17)35(39)40)43-29-33-21-3-1-2-4-24(21)42-29/h1-15H,16H2,(H,31,36)/b30-15+ |
| InChIKey | FJVOFUAUQZPPSA-FJEPWZHXSA-N |
| XLogP | 8.35 |
| TPSA | 153.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.77 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|