C29H19N5O4S2 — CID 3894579
N-[[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide (PubChem CID 3894579) has the molecular formula C29H19N5O4S2 and a molecular weight of 565.64 g/mol. Its IUPAC name is N-[[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide.
| Compound Name | N-[[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 3894579 |
| Molecular Formula | C29H19N5O4S2 |
| Molecular Weight | 565.64 g/mol |
| Exact Mass | 565.09 |
| IUPAC Name | N-[[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide |
| SMILES | O=C(Cn1c2ccccc2c(=O)c2ccccc21)NN=Cc1ccc(Sc2nc3ccccc3s2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H19N5O4S2/c35-27(17-33-22-10-4-1-7-19(22)28(36)20-8-2-5-11-23(20)33)32-30-16-18-13-14-26(24(15-18)34(37)38)40-29-31-21-9-3-6-12-25(21)39-29/h1-16H,17H2,(H,32,35) |
| InChIKey | HUHDFULZZUYTIU-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.64 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|