C22H16N4O4S2 — CID 3430355
N-[[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]methylideneamino]-2-phenoxyacetamide (PubChem CID 3430355) has the molecular formula C22H16N4O4S2 and a molecular weight of 464.53 g/mol. Its IUPAC name is N-[[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]methylideneamino]-2-phenoxyacetamide.
| Compound Name | N-[[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]methylideneamino]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 3430355 |
| Molecular Formula | C22H16N4O4S2 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | N-[[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]methylideneamino]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)NN=Cc1ccc(Sc2nc3ccccc3s2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H16N4O4S2/c27-21(14-30-16-6-2-1-3-7-16)25-23-13-15-10-11-20(18(12-15)26(28)29)32-22-24-17-8-4-5-9-19(17)31-22/h1-13H,14H2,(H,25,27) |
| InChIKey | FIDZFGMOKGBWJF-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 106.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|