C17H15N5O3S — CID 9031064
2-(1,3-benzothiazol-2-ylamino)-N-[(Z)-(4-methyl-3-nitrophenyl)methylideneamino]acetamide (PubChem CID 9031064) has the molecular formula C17H15N5O3S and a molecular weight of 369.41 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylamino)-N-[(Z)-(4-methyl-3-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylamino)-N-[(Z)-(4-methyl-3-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 9031064 |
| Molecular Formula | C17H15N5O3S |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylamino)-N-[(Z)-(4-methyl-3-nitrophenyl)methylideneamino]acetamide |
| SMILES | Cc1ccc(/C=N\NC(=O)CNc2nc3ccccc3s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H15N5O3S/c1-11-6-7-12(8-14(11)22(24)25)9-19-21-16(23)10-18-17-20-13-4-2-3-5-15(13)26-17/h2-9H,10H2,1H3,(H,18,20)(H,21,23)/b19-9- |
| InChIKey | AENHCBOAHZRXEM-OCKHKDLRSA-N |
| XLogP | 3.08 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|