C16H12Cl2N4OS — CID 9030524
2-(1,3-benzothiazol-2-ylamino)-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]acetamide (PubChem CID 9030524) has the molecular formula C16H12Cl2N4OS and a molecular weight of 379.27 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylamino)-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylamino)-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 9030524 |
| Molecular Formula | C16H12Cl2N4OS |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylamino)-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]acetamide |
| SMILES | O=C(CNc1nc2ccccc2s1)N/N=C\c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H12Cl2N4OS/c17-11-6-5-10(12(18)7-11)8-20-22-15(23)9-19-16-21-13-3-1-2-4-14(13)24-16/h1-8H,9H2,(H,19,21)(H,22,23)/b20-8- |
| InChIKey | FKPQTMVNRSSKJJ-ZBKNUEDVSA-N |
| XLogP | 4.17 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|