C14H18N4OS — CID 9030710
2-(1,3-benzothiazol-2-ylamino)-N-(pentan-3-ylideneamino)acetamide (PubChem CID 9030710) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylamino)-N-(pentan-3-ylideneamino)acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylamino)-N-(pentan-3-ylideneamino)acetamide |
|---|---|
| PubChem CID | 9030710 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylamino)-N-(pentan-3-ylideneamino)acetamide |
| SMILES | CCC(CC)=NNC(=O)CNc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H18N4OS/c1-3-10(4-2)17-18-13(19)9-15-14-16-11-7-5-6-8-12(11)20-14/h5-8H,3-4,9H2,1-2H3,(H,15,16)(H,18,19) |
| InChIKey | CZERLXPOTRMKKS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|