C16H14N4O2S — CID 135771298
2-(1,3-benzothiazol-2-ylamino)-N-[(E)-(4-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 135771298) has the molecular formula C16H14N4O2S and a molecular weight of 326.38 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylamino)-N-[(E)-(4-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylamino)-N-[(E)-(4-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135771298 |
| Molecular Formula | C16H14N4O2S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylamino)-N-[(E)-(4-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | O=C(CNc1nc2ccccc2s1)N/N=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C16H14N4O2S/c21-12-7-5-11(6-8-12)9-18-20-15(22)10-17-16-19-13-3-1-2-4-14(13)23-16/h1-9,21H,10H2,(H,17,19)(H,20,22)/b18-9+ |
| InChIKey | FEZXFFFGKUAWTH-GIJQJNRQSA-N |
| XLogP | 2.56 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|