C17H14F2N4O2S — CID 9030622
2-(1,3-benzothiazol-2-ylamino)-N-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]acetamide (PubChem CID 9030622) has the molecular formula C17H14F2N4O2S and a molecular weight of 376.39 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylamino)-N-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylamino)-N-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 9030622 |
| Molecular Formula | C17H14F2N4O2S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylamino)-N-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]acetamide |
| SMILES | O=C(CNc1nc2ccccc2s1)N/N=C\c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H14F2N4O2S/c18-16(19)25-12-7-5-11(6-8-12)9-21-23-15(24)10-20-17-22-13-3-1-2-4-14(13)26-17/h1-9,16H,10H2,(H,20,22)(H,23,24)/b21-9- |
| InChIKey | QUGARLFSMFRLOT-NKVSQWTQSA-N |
| XLogP | 3.46 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|