C16H12N3O3S- — CID 7457404
2-[4-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]phenoxy]acetate (PubChem CID 7457404) has the molecular formula C16H12N3O3S- and a molecular weight of 326.36 g/mol. Its IUPAC name is 2-[4-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]phenoxy]acetate.
| Compound Name | 2-[4-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 7457404 |
| Molecular Formula | C16H12N3O3S- |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 2-[4-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]phenoxy]acetate |
| SMILES | O=C([O-])COc1ccc(/C=N\Nc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C16H13N3O3S/c20-15(21)10-22-12-7-5-11(6-8-12)9-17-19-16-18-13-3-1-2-4-14(13)23-16/h1-9H,10H2,(H,18,19)(H,20,21)/p-1/b17-9- |
| InChIKey | RRRPRDMABXXUEM-MFOYZWKCSA-M |
| XLogP | 1.87 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|