C14H9Cl2N3OS — CID 135630268
4-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-2,6-dichlorophenol (PubChem CID 135630268) has the molecular formula C14H9Cl2N3OS and a molecular weight of 338.22 g/mol. Its IUPAC name is 4-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-2,6-dichlorophenol.
| Compound Name | 4-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-2,6-dichlorophenol |
|---|---|
| PubChem CID | 135630268 |
| Molecular Formula | C14H9Cl2N3OS |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | 4-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-2,6-dichlorophenol |
| SMILES | Oc1c(Cl)cc(/C=N/Nc2nc3ccccc3s2)cc1Cl |
| InChI | InChI=1S/C14H9Cl2N3OS/c15-9-5-8(6-10(16)13(9)20)7-17-19-14-18-11-3-1-2-4-12(11)21-14/h1-7,20H,(H,18,19)/b17-7+ |
| InChIKey | UKNRBTLCZIUIKV-REZTVBANSA-N |
| XLogP | 4.75 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|