C21H17N3OS — CID 139801856
N-[[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]methylideneamino]aniline (PubChem CID 139801856) has the molecular formula C21H17N3OS and a molecular weight of 359.45 g/mol. Its IUPAC name is N-[[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]methylideneamino]aniline.
| Compound Name | N-[[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 139801856 |
| Molecular Formula | C21H17N3OS |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | N-[[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]methylideneamino]aniline |
| SMILES | C(=NNc1ccccc1)c1ccc(OCc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C21H17N3OS/c1-2-6-17(7-3-1)24-22-14-16-10-12-18(13-11-16)25-15-21-23-19-8-4-5-9-20(19)26-21/h1-14,24H,15H2 |
| InChIKey | QLBWVHHTQMJOPZ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|