C14H13N3OS — CID 139801727
[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]hydrazine (PubChem CID 139801727) has the molecular formula C14H13N3OS and a molecular weight of 271.35 g/mol. Its IUPAC name is [4-(1,3-benzothiazol-2-ylmethoxy)phenyl]hydrazine.
| Compound Name | [4-(1,3-benzothiazol-2-ylmethoxy)phenyl]hydrazine |
|---|---|
| PubChem CID | 139801727 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | [4-(1,3-benzothiazol-2-ylmethoxy)phenyl]hydrazine |
| SMILES | NNc1ccc(OCc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C14H13N3OS/c15-17-10-5-7-11(8-6-10)18-9-14-16-12-3-1-2-4-13(12)19-14/h1-8,17H,9,15H2 |
| InChIKey | KKNHGZHYIWBXKB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|