C17H12N2OS2 — CID 139801893
2-[[4-(1,3-thiazol-4-yl)phenoxy]methyl]-1,3-benzothiazole (PubChem CID 139801893) has the molecular formula C17H12N2OS2 and a molecular weight of 324.43 g/mol. Its IUPAC name is 2-[[4-(1,3-thiazol-4-yl)phenoxy]methyl]-1,3-benzothiazole.
| Compound Name | 2-[[4-(1,3-thiazol-4-yl)phenoxy]methyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 139801893 |
| Molecular Formula | C17H12N2OS2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 2-[[4-(1,3-thiazol-4-yl)phenoxy]methyl]-1,3-benzothiazole |
| SMILES | c1ccc2sc(COc3ccc(-c4cscn4)cc3)nc2c1 |
| InChI | InChI=1S/C17H12N2OS2/c1-2-4-16-14(3-1)19-17(22-16)9-20-13-7-5-12(6-8-13)15-10-21-11-18-15/h1-8,10-11H,9H2 |
| InChIKey | CEHSZWCMONCTCO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |