C19H14N2O2S — CID 139801837
1-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]pyridin-2-one (PubChem CID 139801837) has the molecular formula C19H14N2O2S and a molecular weight of 334.40 g/mol. Its IUPAC name is 1-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]pyridin-2-one.
| Compound Name | 1-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]pyridin-2-one |
|---|---|
| PubChem CID | 139801837 |
| Molecular Formula | C19H14N2O2S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 1-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]pyridin-2-one |
| SMILES | O=c1ccccn1-c1ccc(OCc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C19H14N2O2S/c22-19-7-3-4-12-21(19)14-8-10-15(11-9-14)23-13-18-20-16-5-1-2-6-17(16)24-18/h1-12H,13H2 |
| InChIKey | NTTKKTBWBKDRQF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |