C18H14N2O3S2 — CID 14301815
5-[[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 14301815) has the molecular formula C18H14N2O3S2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 5-[[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 14301815 |
| Molecular Formula | C18H14N2O3S2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | 5-[[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cc2ccc(OCc3nc4ccccc4s3)cc2)S1 |
| InChI | InChI=1S/C18H14N2O3S2/c21-17-15(25-18(22)20-17)9-11-5-7-12(8-6-11)23-10-16-19-13-3-1-2-4-14(13)24-16/h1-8,15H,9-10H2,(H,20,21,22) |
| InChIKey | JECICJBEODLEAY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|