C18H14FNO4S — CID 144721168
(5R)-5-[[4-[2-(2-fluorophenyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 144721168) has the molecular formula C18H14FNO4S and a molecular weight of 359.38 g/mol. Its IUPAC name is (5R)-5-[[4-[2-(2-fluorophenyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5R)-5-[[4-[2-(2-fluorophenyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 144721168 |
| Molecular Formula | C18H14FNO4S |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | (5R)-5-[[4-[2-(2-fluorophenyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@@H](Cc2ccc(OCC(=O)c3ccccc3F)cc2)S1 |
| InChI | InChI=1S/C18H14FNO4S/c19-14-4-2-1-3-13(14)15(21)10-24-12-7-5-11(6-8-12)9-16-17(22)20-18(23)25-16/h1-8,16H,9-10H2,(H,20,22,23)/t16-/m1/s1 |
| InChIKey | OXHSWPDYQGAFEI-MRXNPFEDSA-N |
| XLogP | 2.98 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|