About 5-[[4-[2-(2-chlorophenyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidin-4-one
5-[[4-[2-(2-chlorophenyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidin-4-one (PubChem CID 170008693) has the molecular formula C18H16ClNO3S
and a molecular weight of 361.85 g/mol. Its IUPAC name is 5-[[4-[2-(2-chlorophenyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 5-[[4-[2-(2-chlorophenyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidin-4-one |
| PubChem CID | 170008693 |
| Molecular Formula | C18H16ClNO3S |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 5-[[4-[2-(2-chlorophenyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidin-4-one |
| SMILES | O=C(COc1ccc(CC2SCNC2=O)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C18H16ClNO3S/c19-15-4-2-1-3-14(15)16(21)10-23-13-7-5-12(6-8-13)9-17-18(22)20-11-24-17/h1-8,17H,9-11H2,(H,20,22) |
| InChIKey | SCBSXGUVYLXURV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[[4-[2-(2-chlorophenyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[4-[2-(2-chlorophenyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidin-4-one?
The IUPAC name of 5-[[4-[2-(2-chlorophenyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidin-4-one (CID 170008693) is 5-[[4-[2-(2-chlorophenyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidin-4-one.
What is the SMILES notation for 5-[[4-[2-(2-chlorophenyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidin-4-one?
The canonical SMILES for 5-[[4-[2-(2-chlorophenyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidin-4-one is O=C(COc1ccc(CC2SCNC2=O)cc1)c1ccccc1Cl.
What is the InChIKey of 5-[[4-[2-(2-chlorophenyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidin-4-one?
The InChIKey is SCBSXGUVYLXURV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16ClNO3S/c19-15-4-2-1-3-14(15)16(21)10-23-13-7-5-12(6-8-13)9-17-18(22)20-11-24-17/h1-8,17H,9-11H2,(H,20,22).
What are the key properties of 5-[[4-[2-(2-chlorophenyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidin-4-one?
5-[[4-[2-(2-chlorophenyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidin-4-one has a molecular weight of 361.85 g/mol, XLogP of 3.33, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[4-[2-(2-chlorophenyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidin-4-one is sourced from PubChem (CID 170008693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).