C21H19F2NO5S — CID 130308020
5-[[4-[2-[4-(1,1-difluoropropoxy)phenyl]-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 130308020) has the molecular formula C21H19F2NO5S and a molecular weight of 435.45 g/mol. Its IUPAC name is 5-[[4-[2-[4-(1,1-difluoropropoxy)phenyl]-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-[4-(1,1-difluoropropoxy)phenyl]-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 130308020 |
| Molecular Formula | C21H19F2NO5S |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 5-[[4-[2-[4-(1,1-difluoropropoxy)phenyl]-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCC(F)(F)Oc1ccc(C(=O)COc2ccc(CC3SC(=O)NC3=O)cc2)cc1 |
| InChI | InChI=1S/C21H19F2NO5S/c1-2-21(22,23)29-16-9-5-14(6-10-16)17(25)12-28-15-7-3-13(4-8-15)11-18-19(26)24-20(27)30-18/h3-10,18H,2,11-12H2,1H3,(H,24,26,27) |
| InChIKey | MRXJMFGXVPRYAX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|