C14H16BrNO3S — CID 141462409
5-[[4-(4-bromobutoxy)phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 141462409) has the molecular formula C14H16BrNO3S and a molecular weight of 358.26 g/mol. Its IUPAC name is 5-[[4-(4-bromobutoxy)phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-(4-bromobutoxy)phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 141462409 |
| Molecular Formula | C14H16BrNO3S |
| Molecular Weight | 358.26 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 5-[[4-(4-bromobutoxy)phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cc2ccc(OCCCCBr)cc2)S1 |
| InChI | InChI=1S/C14H16BrNO3S/c15-7-1-2-8-19-11-5-3-10(4-6-11)9-12-13(17)16-14(18)20-12/h3-6,12H,1-2,7-9H2,(H,16,17,18) |
| InChIKey | FJHNXWSGJHBDCW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|