C16H15IN2O3S — CID 142851354
5-[[4-[2-(1λ3-ioda-2-azacyclohexa-1,3,5-trien-3-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 142851354) has the molecular formula C16H15IN2O3S and a molecular weight of 442.28 g/mol. Its IUPAC name is 5-[[4-[2-(1λ3-ioda-2-azacyclohexa-1,3,5-trien-3-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-(1λ3-ioda-2-azacyclohexa-1,3,5-trien-3-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 142851354 |
| Molecular Formula | C16H15IN2O3S |
| Molecular Weight | 442.28 g/mol |
| Exact Mass | 441.98 |
| IUPAC Name | 5-[[4-[2-(1λ3-ioda-2-azacyclohexa-1,3,5-trien-3-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cc2ccc(OCCC3=CC=CI=N3)cc2)S1 |
| InChI | InChI=1S/C16H15IN2O3S/c20-15-14(23-16(21)18-15)10-11-3-5-13(6-4-11)22-9-7-12-2-1-8-17-19-12/h1-6,8,14H,7,9-10H2,(H,18,20,21) |
| InChIKey | ZROSEJBWHLLAHX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.28 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|