C29H23N3O4S — CID 150398739
5-[[4-[(1-methyl-6-naphthalen-2-yloxybenzimidazol-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 150398739) has the molecular formula C29H23N3O4S and a molecular weight of 509.59 g/mol. Its IUPAC name is 5-[[4-[(1-methyl-6-naphthalen-2-yloxybenzimidazol-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[(1-methyl-6-naphthalen-2-yloxybenzimidazol-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 150398739 |
| Molecular Formula | C29H23N3O4S |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | 5-[[4-[(1-methyl-6-naphthalen-2-yloxybenzimidazol-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cn1c(COc2ccc(CC3SC(=O)NC3=O)cc2)nc2ccc(Oc3ccc4ccccc4c3)cc21 |
| InChI | InChI=1S/C29H23N3O4S/c1-32-25-16-23(36-22-11-8-19-4-2-3-5-20(19)15-22)12-13-24(25)30-27(32)17-35-21-9-6-18(7-10-21)14-26-28(33)31-29(34)37-26/h2-13,15-16,26H,14,17H2,1H3,(H,31,33,34) |
| InChIKey | HDHNCDILRPOJBO-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|