C32H33N5O4S2 — CID 10167909
1-cyclohexyl-3-[4-[2-[[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]methyl]-3-methylbenzimidazol-5-yl]oxyphenyl]thiourea (PubChem CID 10167909) has the molecular formula C32H33N5O4S2 and a molecular weight of 615.78 g/mol. Its IUPAC name is 1-cyclohexyl-3-[4-[2-[[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]methyl]-3-methylbenzimidazol-5-yl]oxyphenyl]thiourea.
| Compound Name | 1-cyclohexyl-3-[4-[2-[[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]methyl]-3-methylbenzimidazol-5-yl]oxyphenyl]thiourea |
|---|---|
| PubChem CID | 10167909 |
| Molecular Formula | C32H33N5O4S2 |
| Molecular Weight | 615.78 g/mol |
| Exact Mass | 615.20 |
| IUPAC Name | 1-cyclohexyl-3-[4-[2-[[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]methyl]-3-methylbenzimidazol-5-yl]oxyphenyl]thiourea |
| SMILES | Cn1c(COc2ccc(CC3SC(=O)NC3=O)cc2)nc2ccc(Oc3ccc(NC(=S)NC4CCCCC4)cc3)cc21 |
| InChI | InChI=1S/C32H33N5O4S2/c1-37-27-18-25(41-24-13-9-22(10-14-24)34-31(42)33-21-5-3-2-4-6-21)15-16-26(27)35-29(37)19-40-23-11-7-20(8-12-23)17-28-30(38)36-32(39)43-28/h7-16,18,21,28H,2-6,17,19H2,1H3,(H2,33,34,42)(H,36,38,39) |
| InChIKey | KOYFXBYRJOCIEF-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.78 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|