C31H25N3O4S — CID 86758434
5-[[4-[[1-methyl-6-(2-phenylphenoxy)benzimidazol-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 86758434) has the molecular formula C31H25N3O4S and a molecular weight of 535.63 g/mol. Its IUPAC name is 5-[[4-[[1-methyl-6-(2-phenylphenoxy)benzimidazol-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[[1-methyl-6-(2-phenylphenoxy)benzimidazol-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 86758434 |
| Molecular Formula | C31H25N3O4S |
| Molecular Weight | 535.63 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | 5-[[4-[[1-methyl-6-(2-phenylphenoxy)benzimidazol-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cn1c(COc2ccc(CC3SC(=O)NC3=O)cc2)nc2ccc(Oc3ccccc3-c3ccccc3)cc21 |
| InChI | InChI=1S/C31H25N3O4S/c1-34-26-18-23(38-27-10-6-5-9-24(27)21-7-3-2-4-8-21)15-16-25(26)32-29(34)19-37-22-13-11-20(12-14-22)17-28-30(35)33-31(36)39-28/h2-16,18,28H,17,19H2,1H3,(H,33,35,36) |
| InChIKey | ITNYZILHHJKJSA-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.63 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|