C25H29N3O10S — CID 91200186
methanol;5-[[4-[[1-methyl-6-[(2R,4R,5S)-3,4,5,6-tetrahydroxyoxan-2-yl]oxybenzimidazol-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 91200186) has the molecular formula C25H29N3O10S and a molecular weight of 563.59 g/mol. Its IUPAC name is methanol;5-[[4-[[1-methyl-6-[(2R,4R,5S)-3,4,5,6-tetrahydroxyoxan-2-yl]oxybenzimidazol-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | methanol;5-[[4-[[1-methyl-6-[(2R,4R,5S)-3,4,5,6-tetrahydroxyoxan-2-yl]oxybenzimidazol-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 91200186 |
| Molecular Formula | C25H29N3O10S |
| Molecular Weight | 563.59 g/mol |
| Exact Mass | 563.16 |
| IUPAC Name | methanol;5-[[4-[[1-methyl-6-[(2R,4R,5S)-3,4,5,6-tetrahydroxyoxan-2-yl]oxybenzimidazol-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CO.Cn1c(COc2ccc(CC3SC(=O)NC3=O)cc2)nc2ccc(O[C@@H]3OC(O)[C@@H](O)[C@@H](O)C3O)cc21 |
| InChI | InChI=1S/C24H25N3O9S.CH4O/c1-27-15-9-13(35-23-20(30)18(28)19(29)22(32)36-23)6-7-14(15)25-17(27)10-34-12-4-2-11(3-5-12)8-16-21(31)26-24(33)37-16;1-2/h2-7,9,16,18-20,22-23,28-30,32H,8,10H2,1H3,(H,26,31,33);2H,1H3/t16?,18-,19+,20?,22?,23-;/m1./s1 |
| InChIKey | VAOQNXRQCODIIL-QAJMBPFQSA-N |
| XLogP | -0.21 |
| TPSA | 192.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.59 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|