C31H36Cl2N4O4S — CID 87498529
5-[[4-[[6-[2-(3-amino-4-butylphenyl)ethoxy]-1-methylbenzimidazol-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;dihydrochloride (PubChem CID 87498529) has the molecular formula C31H36Cl2N4O4S and a molecular weight of 631.63 g/mol. Its IUPAC name is 5-[[4-[[6-[2-(3-amino-4-butylphenyl)ethoxy]-1-methylbenzimidazol-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;dihydrochloride.
| Compound Name | 5-[[4-[[6-[2-(3-amino-4-butylphenyl)ethoxy]-1-methylbenzimidazol-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;dihydrochloride |
|---|---|
| PubChem CID | 87498529 |
| Molecular Formula | C31H36Cl2N4O4S |
| Molecular Weight | 631.63 g/mol |
| Exact Mass | 630.18 |
| IUPAC Name | 5-[[4-[[6-[2-(3-amino-4-butylphenyl)ethoxy]-1-methylbenzimidazol-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;dihydrochloride |
| SMILES | CCCCc1ccc(CCOc2ccc3nc(COc4ccc(CC5SC(=O)NC5=O)cc4)n(C)c3c2)cc1N.Cl.Cl |
| InChI | InChI=1S/C31H34N4O4S.2ClH/c1-3-4-5-22-9-6-21(16-25(22)32)14-15-38-24-12-13-26-27(18-24)35(2)29(33-26)19-39-23-10-7-20(8-11-23)17-28-30(36)34-31(37)40-28;;/h6-13,16,18,28H,3-5,14-15,17,19,32H2,1-2H3,(H,34,36,37);2*1H |
| InChIKey | YWFPBUHNHYAEJL-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.63 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|