C17H13NO2S — CID 104986102
5-(1,3-benzothiazol-2-ylmethoxy)-2,3-dihydroinden-1-one (PubChem CID 104986102) has the molecular formula C17H13NO2S and a molecular weight of 295.36 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-ylmethoxy)-2,3-dihydroinden-1-one.
| Compound Name | 5-(1,3-benzothiazol-2-ylmethoxy)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 104986102 |
| Molecular Formula | C17H13NO2S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 5-(1,3-benzothiazol-2-ylmethoxy)-2,3-dihydroinden-1-one |
| SMILES | O=C1CCc2cc(OCc3nc4ccccc4s3)ccc21 |
| InChI | InChI=1S/C17H13NO2S/c19-15-8-5-11-9-12(6-7-13(11)15)20-10-17-18-14-3-1-2-4-16(14)21-17/h1-4,6-7,9H,5,8,10H2 |
| InChIKey | RRCNEIYUESTYCW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |