C29H21N3OS — CID 139801756
2-[[4-(3,5-diphenylpyrazol-1-yl)phenoxy]methyl]-1,3-benzothiazole (PubChem CID 139801756) has the molecular formula C29H21N3OS and a molecular weight of 459.57 g/mol. Its IUPAC name is 2-[[4-(3,5-diphenylpyrazol-1-yl)phenoxy]methyl]-1,3-benzothiazole.
| Compound Name | 2-[[4-(3,5-diphenylpyrazol-1-yl)phenoxy]methyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 139801756 |
| Molecular Formula | C29H21N3OS |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 2-[[4-(3,5-diphenylpyrazol-1-yl)phenoxy]methyl]-1,3-benzothiazole |
| SMILES | c1ccc(-c2cc(-c3ccccc3)n(-c3ccc(OCc4nc5ccccc5s4)cc3)n2)cc1 |
| InChI | InChI=1S/C29H21N3OS/c1-3-9-21(10-4-1)26-19-27(22-11-5-2-6-12-22)32(31-26)23-15-17-24(18-16-23)33-20-29-30-25-13-7-8-14-28(25)34-29/h1-19H,20H2 |
| InChIKey | FSSDUOIZNNNUAJ-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |