C20H14FN3O3S2 — CID 126027109
[4-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 126027109) has the molecular formula C20H14FN3O3S2 and a molecular weight of 427.48 g/mol. Its IUPAC name is [4-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 126027109 |
| Molecular Formula | C20H14FN3O3S2 |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | [4-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | O=S(=O)(Oc1ccc(/C=N\Nc2nc3ccccc3s2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H14FN3O3S2/c21-15-7-11-17(12-8-15)29(25,26)27-16-9-5-14(6-10-16)13-22-24-20-23-18-3-1-2-4-19(18)28-20/h1-13H,(H,23,24)/b22-13- |
| InChIKey | QFDKVFMPEVDPMX-XKZIYDEJSA-N |
| XLogP | 4.65 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|