C20H18N2O3S — CID 26012790
[4-[(Z)-(phenylhydrazinylidene)methyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 26012790) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is [4-[(Z)-(phenylhydrazinylidene)methyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[(Z)-(phenylhydrazinylidene)methyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 26012790 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | [4-[(Z)-(phenylhydrazinylidene)methyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(/C=N\Nc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C20H18N2O3S/c1-16-7-13-20(14-8-16)26(23,24)25-19-11-9-17(10-12-19)15-21-22-18-5-3-2-4-6-18/h2-15,22H,1H3/b21-15- |
| InChIKey | SAIVUUQYQOGPKS-QNGOZBTKSA-N |
| XLogP | 4.21 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|