C38H34N4O8S2 — CID 6151740
[4-[(Z)-[[2-benzyl-3-[(2Z)-2-[[4-(4-methylphenyl)sulfonyloxyphenyl]methylidene]hydrazinyl]-3-oxopropanoyl]hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 6151740) has the molecular formula C38H34N4O8S2 and a molecular weight of 738.84 g/mol. Its IUPAC name is [4-[(Z)-[[2-benzyl-3-[(2Z)-2-[[4-(4-methylphenyl)sulfonyloxyphenyl]methylidene]hydrazinyl]-3-oxopropanoyl]hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[(Z)-[[2-benzyl-3-[(2Z)-2-[[4-(4-methylphenyl)sulfonyloxyphenyl]methylidene]hydrazinyl]-3-oxopropanoyl]hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 6151740 |
| Molecular Formula | C38H34N4O8S2 |
| Molecular Weight | 738.84 g/mol |
| Exact Mass | 738.18 |
| IUPAC Name | [4-[(Z)-[[2-benzyl-3-[(2Z)-2-[[4-(4-methylphenyl)sulfonyloxyphenyl]methylidene]hydrazinyl]-3-oxopropanoyl]hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(/C=N\NC(=O)C(Cc3ccccc3)C(=O)N/N=C\c3ccc(OS(=O)(=O)c4ccc(C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H34N4O8S2/c1-27-8-20-34(21-9-27)51(45,46)49-32-16-12-30(13-17-32)25-39-41-37(43)36(24-29-6-4-3-5-7-29)38(44)42-40-26-31-14-18-33(19-15-31)50-52(47,48)35-22-10-28(2)11-23-35/h3-23,25-26,36H,24H2,1-2H3,(H,41,43)(H,42,44)/b39-25-,40-26- |
| InChIKey | SZCKVEQBTVOTNS-QASZCPKBSA-N |
| XLogP | 5.30 |
| TPSA | 169.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.84 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|