C14H13N3O3S2 — CID 5194053
[4-[(carbamothioylhydrazinylidene)methyl]phenyl] benzenesulfonate (PubChem CID 5194053) has the molecular formula C14H13N3O3S2 and a molecular weight of 335.41 g/mol. Its IUPAC name is [4-[(carbamothioylhydrazinylidene)methyl]phenyl] benzenesulfonate.
| Compound Name | [4-[(carbamothioylhydrazinylidene)methyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 5194053 |
| Molecular Formula | C14H13N3O3S2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | [4-[(carbamothioylhydrazinylidene)methyl]phenyl] benzenesulfonate |
| SMILES | NC(=S)NN=Cc1ccc(OS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C14H13N3O3S2/c15-14(21)17-16-10-11-6-8-12(9-7-11)20-22(18,19)13-4-2-1-3-5-13/h1-10H,(H3,15,17,21) |
| InChIKey | SGMIYSZTPUEVIP-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|