C24H24N6O2S2 — CID 139235234
[(Z)-[4-[[2-[[4-[(Z)-(carbamothioylhydrazinylidene)methyl]phenoxy]methyl]phenyl]methoxy]phenyl]methylideneamino]thiourea (PubChem CID 139235234) has the molecular formula C24H24N6O2S2 and a molecular weight of 492.63 g/mol. Its IUPAC name is [(Z)-[4-[[2-[[4-[(Z)-(carbamothioylhydrazinylidene)methyl]phenoxy]methyl]phenyl]methoxy]phenyl]methylideneamino]thiourea.
| Compound Name | [(Z)-[4-[[2-[[4-[(Z)-(carbamothioylhydrazinylidene)methyl]phenoxy]methyl]phenyl]methoxy]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 139235234 |
| Molecular Formula | C24H24N6O2S2 |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | [(Z)-[4-[[2-[[4-[(Z)-(carbamothioylhydrazinylidene)methyl]phenoxy]methyl]phenyl]methoxy]phenyl]methylideneamino]thiourea |
| SMILES | NC(=S)N/N=C\c1ccc(OCc2ccccc2COc2ccc(/C=N\NC(N)=S)cc2)cc1 |
| InChI | InChI=1S/C24H24N6O2S2/c25-23(33)29-27-13-17-5-9-21(10-6-17)31-15-19-3-1-2-4-20(19)16-32-22-11-7-18(8-12-22)14-28-30-24(26)34/h1-14H,15-16H2,(H3,25,29,33)(H3,26,30,34)/b27-13-,28-14- |
| InChIKey | RTANEEIHBBIAND-JEGUCOMDSA-N |
| XLogP | 3.18 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|