C15H12F3N3OS — CID 168534625
[[2-[(3,4,5-trifluorophenoxy)methyl]phenyl]methylideneamino]thiourea (PubChem CID 168534625) has the molecular formula C15H12F3N3OS and a molecular weight of 339.34 g/mol. Its IUPAC name is [[2-[(3,4,5-trifluorophenoxy)methyl]phenyl]methylideneamino]thiourea.
| Compound Name | [[2-[(3,4,5-trifluorophenoxy)methyl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 168534625 |
| Molecular Formula | C15H12F3N3OS |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | [[2-[(3,4,5-trifluorophenoxy)methyl]phenyl]methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1ccccc1COc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C15H12F3N3OS/c16-12-5-11(6-13(17)14(12)18)22-8-10-4-2-1-3-9(10)7-20-21-15(19)23/h1-7H,8H2,(H3,19,21,23) |
| InChIKey | VJRVAZCDBKMFLM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|