C42H42N12O4S4 — CID 139236029
[(E)-[2-[[2,4,5-tris[[2-[(E)-(carbamothioylhydrazinylidene)methyl]phenoxy]methyl]phenyl]methoxy]phenyl]methylideneamino]thiourea (PubChem CID 139236029) has the molecular formula C42H42N12O4S4 and a molecular weight of 907.15 g/mol. Its IUPAC name is [(E)-[2-[[2,4,5-tris[[2-[(E)-(carbamothioylhydrazinylidene)methyl]phenoxy]methyl]phenyl]methoxy]phenyl]methylideneamino]thiourea.
| Compound Name | [(E)-[2-[[2,4,5-tris[[2-[(E)-(carbamothioylhydrazinylidene)methyl]phenoxy]methyl]phenyl]methoxy]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 139236029 |
| Molecular Formula | C42H42N12O4S4 |
| Molecular Weight | 907.15 g/mol |
| Exact Mass | 906.23 |
| IUPAC Name | [(E)-[2-[[2,4,5-tris[[2-[(E)-(carbamothioylhydrazinylidene)methyl]phenoxy]methyl]phenyl]methoxy]phenyl]methylideneamino]thiourea |
| SMILES | NC(=S)N/N=C/c1ccccc1OCc1cc(COc2ccccc2/C=N/NC(N)=S)c(COc2ccccc2/C=N/NC(N)=S)cc1COc1ccccc1/C=N/NC(N)=S |
| InChI | InChI=1S/C42H42N12O4S4/c43-39(59)51-47-19-27-9-1-5-13-35(27)55-23-31-17-33(25-57-37-15-7-3-11-29(37)21-49-53-41(45)61)34(26-58-38-16-8-4-12-30(38)22-50-54-42(46)62)18-32(31)24-56-36-14-6-2-10-28(36)20-48-52-40(44)60/h1-22H,23-26H2,(H3,43,51,59)(H3,44,52,60)(H3,45,53,61)(H3,46,54,62)/b47-19+,48-20+,49-21+,50-22+ |
| InChIKey | SYISDXAWQXTMAR-ZCURJLBPSA-N |
| XLogP | 4.67 |
| TPSA | 238.56 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.15 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|