C15H12Cl2FN3OS — CID 168535185
[[5-chloro-2-[(2-chloro-4-fluorophenyl)methoxy]phenyl]methylideneamino]thiourea (PubChem CID 168535185) has the molecular formula C15H12Cl2FN3OS and a molecular weight of 372.25 g/mol. Its IUPAC name is [[5-chloro-2-[(2-chloro-4-fluorophenyl)methoxy]phenyl]methylideneamino]thiourea.
| Compound Name | [[5-chloro-2-[(2-chloro-4-fluorophenyl)methoxy]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 168535185 |
| Molecular Formula | C15H12Cl2FN3OS |
| Molecular Weight | 372.25 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | [[5-chloro-2-[(2-chloro-4-fluorophenyl)methoxy]phenyl]methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1cc(Cl)ccc1OCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C15H12Cl2FN3OS/c16-11-2-4-14(10(5-11)7-20-21-15(19)23)22-8-9-1-3-12(18)6-13(9)17/h1-7H,8H2,(H3,19,21,23) |
| InChIKey | KVMQJSWBNAWLPO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.25 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|