C15H13ClF2N4O — CID 168590729
2-[[5-chloro-2-[(2,5-difluorophenyl)methoxy]phenyl]methylideneamino]guanidine (PubChem CID 168590729) has the molecular formula C15H13ClF2N4O and a molecular weight of 338.75 g/mol. Its IUPAC name is 2-[[5-chloro-2-[(2,5-difluorophenyl)methoxy]phenyl]methylideneamino]guanidine.
| Compound Name | 2-[[5-chloro-2-[(2,5-difluorophenyl)methoxy]phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 168590729 |
| Molecular Formula | C15H13ClF2N4O |
| Molecular Weight | 338.75 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 2-[[5-chloro-2-[(2,5-difluorophenyl)methoxy]phenyl]methylideneamino]guanidine |
| SMILES | NC(N)=NN=Cc1cc(Cl)ccc1OCc1cc(F)ccc1F |
| InChI | InChI=1S/C15H13ClF2N4O/c16-11-1-4-14(9(5-11)7-21-22-15(19)20)23-8-10-6-12(17)2-3-13(10)18/h1-7H,8H2,(H4,19,20,22) |
| InChIKey | MMCIIVQBJGYJAY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.75 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|