C10H10ClN5O — CID 168592781
2-[[5-chloro-2-(cyanomethoxy)phenyl]methylideneamino]guanidine (PubChem CID 168592781) has the molecular formula C10H10ClN5O and a molecular weight of 251.68 g/mol. Its IUPAC name is 2-[[5-chloro-2-(cyanomethoxy)phenyl]methylideneamino]guanidine.
| Compound Name | 2-[[5-chloro-2-(cyanomethoxy)phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 168592781 |
| Molecular Formula | C10H10ClN5O |
| Molecular Weight | 251.68 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 2-[[5-chloro-2-(cyanomethoxy)phenyl]methylideneamino]guanidine |
| SMILES | N#CCOc1ccc(Cl)cc1C=NN=C(N)N |
| InChI | InChI=1S/C10H10ClN5O/c11-8-1-2-9(17-4-3-12)7(5-8)6-15-16-10(13)14/h1-2,5-6H,4H2,(H4,13,14,16) |
| InChIKey | ORAWHIDXTAIFGW-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.68 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|