C8H5Cl2NO — CID 3361196
2-(2,5-dichlorophenoxy)acetonitrile (PubChem CID 3361196) has the molecular formula C8H5Cl2NO and a molecular weight of 202.04 g/mol. Its IUPAC name is 2-(2,5-dichlorophenoxy)acetonitrile.
| Compound Name | 2-(2,5-dichlorophenoxy)acetonitrile |
|---|---|
| PubChem CID | 3361196 |
| Molecular Formula | C8H5Cl2NO |
| Molecular Weight | 202.04 g/mol |
| Exact Mass | 200.97 |
| IUPAC Name | 2-(2,5-dichlorophenoxy)acetonitrile |
| SMILES | N#CCOc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C8H5Cl2NO/c9-6-1-2-7(10)8(5-6)12-4-3-11/h1-2,5H,4H2 |
| InChIKey | KAVDBXFGOAPKHB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.04 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |