C16H12Cl4O2 — CID 154157151
1,4-dichloro-2-[2-[(2,5-dichlorophenoxy)methyl]prop-2-enoxy]benzene (PubChem CID 154157151) has the molecular formula C16H12Cl4O2 and a molecular weight of 378.08 g/mol. Its IUPAC name is 1,4-dichloro-2-[2-[(2,5-dichlorophenoxy)methyl]prop-2-enoxy]benzene.
| Compound Name | 1,4-dichloro-2-[2-[(2,5-dichlorophenoxy)methyl]prop-2-enoxy]benzene |
|---|---|
| PubChem CID | 154157151 |
| Molecular Formula | C16H12Cl4O2 |
| Molecular Weight | 378.08 g/mol |
| Exact Mass | 375.96 |
| IUPAC Name | 1,4-dichloro-2-[2-[(2,5-dichlorophenoxy)methyl]prop-2-enoxy]benzene |
| SMILES | C=C(COc1cc(Cl)ccc1Cl)COc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H12Cl4O2/c1-10(8-21-15-6-11(17)2-4-13(15)19)9-22-16-7-12(18)3-5-14(16)20/h2-7H,1,8-9H2 |
| InChIKey | TWQQBDAXLIGIRW-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.08 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|