C14H9Cl2FO2 — CID 60623205
2-(2,5-dichlorophenoxy)-1-(2-fluorophenyl)ethanone (PubChem CID 60623205) has the molecular formula C14H9Cl2FO2 and a molecular weight of 299.13 g/mol. Its IUPAC name is 2-(2,5-dichlorophenoxy)-1-(2-fluorophenyl)ethanone.
| Compound Name | 2-(2,5-dichlorophenoxy)-1-(2-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 60623205 |
| Molecular Formula | C14H9Cl2FO2 |
| Molecular Weight | 299.13 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | 2-(2,5-dichlorophenoxy)-1-(2-fluorophenyl)ethanone |
| SMILES | O=C(COc1cc(Cl)ccc1Cl)c1ccccc1F |
| InChI | InChI=1S/C14H9Cl2FO2/c15-9-5-6-11(16)14(7-9)19-8-13(18)10-3-1-2-4-12(10)17/h1-7H,8H2 |
| InChIKey | WAIABFPBGQOIPW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.13 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |