C14H8BrClF2O2 — CID 60656484
2-(2-bromo-4-chlorophenoxy)-1-(2,4-difluorophenyl)ethanone (PubChem CID 60656484) has the molecular formula C14H8BrClF2O2 and a molecular weight of 361.57 g/mol. Its IUPAC name is 2-(2-bromo-4-chlorophenoxy)-1-(2,4-difluorophenyl)ethanone.
| Compound Name | 2-(2-bromo-4-chlorophenoxy)-1-(2,4-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 60656484 |
| Molecular Formula | C14H8BrClF2O2 |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 359.94 |
| IUPAC Name | 2-(2-bromo-4-chlorophenoxy)-1-(2,4-difluorophenyl)ethanone |
| SMILES | O=C(COc1ccc(Cl)cc1Br)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H8BrClF2O2/c15-11-5-8(16)1-4-14(11)20-7-13(19)10-3-2-9(17)6-12(10)18/h1-6H,7H2 |
| InChIKey | KKYSNAOKAXUBQI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |