C15H8ClF2NO2 — CID 114323759
4-chloro-2-[2-(2,4-difluorophenyl)-2-oxoethoxy]benzonitrile (PubChem CID 114323759) has the molecular formula C15H8ClF2NO2 and a molecular weight of 307.68 g/mol. Its IUPAC name is 4-chloro-2-[2-(2,4-difluorophenyl)-2-oxoethoxy]benzonitrile.
| Compound Name | 4-chloro-2-[2-(2,4-difluorophenyl)-2-oxoethoxy]benzonitrile |
|---|---|
| PubChem CID | 114323759 |
| Molecular Formula | C15H8ClF2NO2 |
| Molecular Weight | 307.68 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 4-chloro-2-[2-(2,4-difluorophenyl)-2-oxoethoxy]benzonitrile |
| SMILES | N#Cc1ccc(Cl)cc1OCC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H8ClF2NO2/c16-10-2-1-9(7-19)15(5-10)21-8-14(20)12-4-3-11(17)6-13(12)18/h1-6H,8H2 |
| InChIKey | QLLHAOLAKUBPGW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.68 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |