C15H9F2NO2 — CID 60643058
2-[2-(2,5-difluorophenyl)-2-oxoethoxy]benzonitrile (PubChem CID 60643058) has the molecular formula C15H9F2NO2 and a molecular weight of 273.24 g/mol. Its IUPAC name is 2-[2-(2,5-difluorophenyl)-2-oxoethoxy]benzonitrile.
| Compound Name | 2-[2-(2,5-difluorophenyl)-2-oxoethoxy]benzonitrile |
|---|---|
| PubChem CID | 60643058 |
| Molecular Formula | C15H9F2NO2 |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 2-[2-(2,5-difluorophenyl)-2-oxoethoxy]benzonitrile |
| SMILES | N#Cc1ccccc1OCC(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C15H9F2NO2/c16-11-5-6-13(17)12(7-11)14(19)9-20-15-4-2-1-3-10(15)8-18/h1-7H,9H2 |
| InChIKey | LDRNIAXDBKOVSB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |