C15H10F2N2O2 — CID 2565570
2-(2-cyanophenoxy)-N-(2,6-difluorophenyl)acetamide (PubChem CID 2565570) has the molecular formula C15H10F2N2O2 and a molecular weight of 288.25 g/mol. Its IUPAC name is 2-(2-cyanophenoxy)-N-(2,6-difluorophenyl)acetamide.
| Compound Name | 2-(2-cyanophenoxy)-N-(2,6-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 2565570 |
| Molecular Formula | C15H10F2N2O2 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 2-(2-cyanophenoxy)-N-(2,6-difluorophenyl)acetamide |
| SMILES | N#Cc1ccccc1OCC(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C15H10F2N2O2/c16-11-5-3-6-12(17)15(11)19-14(20)9-21-13-7-2-1-4-10(13)8-18/h1-7H,9H2,(H,19,20) |
| InChIKey | RSJXCRWOIDKNAO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |